C6H8N2O2S — CID 90989275
(5-ethyl-1,3-thiazol-2-yl)carbamic acid (PubChem CID 90989275) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is (5-ethyl-1,3-thiazol-2-yl)carbamic acid.
| Compound Name | (5-ethyl-1,3-thiazol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 90989275 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | (5-ethyl-1,3-thiazol-2-yl)carbamic acid |
| SMILES | CCc1cnc(NC(=O)O)s1 |
| InChI | InChI=1S/C6H8N2O2S/c1-2-4-3-7-5(11-4)8-6(9)10/h3H,2H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | GCNSUKNMFVAXEN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |