(5-ethyl-1,3-thiazol-2-yl)carbamic acid

C6H8N2O2S — CID 90989275

IUPAC(5-ethyl-1,3-thiazol-2-yl)carbamic acid
SMILESCCc1cnc(NC(=O)O)s1
InChIInChI=1S/C6H8N2O2S/c1-2-4-3-7-5(11-4)8-6(9)10/h3H,2H2,1H3,(H,7,8)(H,9,10)
InChIKeyGCNSUKNMFVAXEN-UHFFFAOYSA-N
MW172.21 g/mol
LogP1.80
Rot. Bonds2

About (5-ethyl-1,3-thiazol-2-yl)carbamic acid

(5-ethyl-1,3-thiazol-2-yl)carbamic acid (PubChem CID 90989275) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is (5-ethyl-1,3-thiazol-2-yl)carbamic acid.

Molecular Properties

Compound Name(5-ethyl-1,3-thiazol-2-yl)carbamic acid
PubChem CID90989275
Molecular FormulaC6H8N2O2S
Molecular Weight172.21 g/mol
Exact Mass172.03
IUPAC Name(5-ethyl-1,3-thiazol-2-yl)carbamic acid
SMILESCCc1cnc(NC(=O)O)s1
InChIInChI=1S/C6H8N2O2S/c1-2-4-3-7-5(11-4)8-6(9)10/h3H,2H2,1H3,(H,7,8)(H,9,10)
InChIKeyGCNSUKNMFVAXEN-UHFFFAOYSA-N
XLogP1.80
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.21
LogP ≤ 51.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (5-ethyl-1,3-thiazol-2-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-ethyl-1,3-thiazol-2-yl)carbamic acid?
The IUPAC name of (5-ethyl-1,3-thiazol-2-yl)carbamic acid (CID 90989275) is (5-ethyl-1,3-thiazol-2-yl)carbamic acid.
What is the SMILES notation for (5-ethyl-1,3-thiazol-2-yl)carbamic acid?
The canonical SMILES for (5-ethyl-1,3-thiazol-2-yl)carbamic acid is CCc1cnc(NC(=O)O)s1.
What is the InChIKey of (5-ethyl-1,3-thiazol-2-yl)carbamic acid?
The InChIKey is GCNSUKNMFVAXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-2-4-3-7-5(11-4)8-6(9)10/h3H,2H2,1H3,(H,7,8)(H,9,10).
What are the key properties of (5-ethyl-1,3-thiazol-2-yl)carbamic acid?
(5-ethyl-1,3-thiazol-2-yl)carbamic acid has a molecular weight of 172.21 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1,3-thiazol-2-yl)carbamic acid is sourced from PubChem (CID 90989275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).