C10H15N3O2S — CID 119755286
N-(5-ethyl-1,3-thiazol-2-yl)morpholine-3-carboxamide (PubChem CID 119755286) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is N-(5-ethyl-1,3-thiazol-2-yl)morpholine-3-carboxamide.
| Compound Name | N-(5-ethyl-1,3-thiazol-2-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119755286 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(5-ethyl-1,3-thiazol-2-yl)morpholine-3-carboxamide |
| SMILES | CCc1cnc(NC(=O)C2COCCN2)s1 |
| InChI | InChI=1S/C10H15N3O2S/c1-2-7-5-12-10(16-7)13-9(14)8-6-15-4-3-11-8/h5,8,11H,2-4,6H2,1H3,(H,12,13,14) |
| InChIKey | YMDPGEJWJZMPIY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |