C11H17N3O3 — CID 114180212
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]morpholine-3-carboxamide (PubChem CID 114180212) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]morpholine-3-carboxamide.
| Compound Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 114180212 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]morpholine-3-carboxamide |
| SMILES | CCc1cnc(CNC(=O)C2COCCN2)o1 |
| InChI | InChI=1S/C11H17N3O3/c1-2-8-5-13-10(17-8)6-14-11(15)9-7-16-4-3-12-9/h5,9,12H,2-4,6-7H2,1H3,(H,14,15) |
| InChIKey | SIGMPBNMPFGIFQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |