C8H12N4O3 — CID 106397009
N-(1,2,4-oxadiazol-3-ylmethyl)morpholine-3-carboxamide (PubChem CID 106397009) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)morpholine-3-carboxamide.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 106397009 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)morpholine-3-carboxamide |
| SMILES | O=C(NCc1ncon1)C1COCCN1 |
| InChI | InChI=1S/C8H12N4O3/c13-8(6-4-14-2-1-9-6)10-3-7-11-5-15-12-7/h5-6,9H,1-4H2,(H,10,13) |
| InChIKey | DLTCYNJGRFVEOH-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |