C10H14BrClN2O2S — CID 119731563
N-[(4-bromothiophen-2-yl)methyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 119731563) has the molecular formula C10H14BrClN2O2S and a molecular weight of 341.66 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119731563 |
| Molecular Formula | C10H14BrClN2O2S |
| Molecular Weight | 341.66 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCc1cc(Br)cs1)C1COCCN1 |
| InChI | InChI=1S/C10H13BrN2O2S.ClH/c11-7-3-8(16-6-7)4-13-10(14)9-5-15-2-1-12-9;/h3,6,9,12H,1-2,4-5H2,(H,13,14);1H |
| InChIKey | YKCLSIBBKYSGFI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.66 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |