C11H14ClN3O2 — CID 113266715
N-(6-chloro-4-methyl-3-pyridinyl)morpholine-3-carboxamide (PubChem CID 113266715) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is N-(6-chloro-4-methyl-3-pyridinyl)morpholine-3-carboxamide.
| Compound Name | N-(6-chloro-4-methyl-3-pyridinyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 113266715 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(6-chloro-4-methyl-3-pyridinyl)morpholine-3-carboxamide |
| SMILES | Cc1cc(Cl)ncc1NC(=O)C1COCCN1 |
| InChI | InChI=1S/C11H14ClN3O2/c1-7-4-10(12)14-5-8(7)15-11(16)9-6-17-3-2-13-9/h4-5,9,13H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | BZNFHEZOKXKFQQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|