C12H15BrN2O2 — CID 82757225
N-(2-bromo-5-methylphenyl)morpholine-3-carboxamide (PubChem CID 82757225) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)morpholine-3-carboxamide.
| Compound Name | N-(2-bromo-5-methylphenyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 82757225 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)morpholine-3-carboxamide |
| SMILES | Cc1ccc(Br)c(NC(=O)C2COCCN2)c1 |
| InChI | InChI=1S/C12H15BrN2O2/c1-8-2-3-9(13)10(6-8)15-12(16)11-7-17-5-4-14-11/h2-3,6,11,14H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | YHESPVNERAANQE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |