C9H11BrN2O2S — CID 115177539
N-(5-bromothiophen-2-yl)morpholine-3-carboxamide (PubChem CID 115177539) has the molecular formula C9H11BrN2O2S and a molecular weight of 291.17 g/mol. Its IUPAC name is N-(5-bromothiophen-2-yl)morpholine-3-carboxamide.
| Compound Name | N-(5-bromothiophen-2-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 115177539 |
| Molecular Formula | C9H11BrN2O2S |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | N-(5-bromothiophen-2-yl)morpholine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)s1)C1COCCN1 |
| InChI | InChI=1S/C9H11BrN2O2S/c10-7-1-2-8(15-7)12-9(13)6-5-14-4-3-11-6/h1-2,6,11H,3-5H2,(H,12,13) |
| InChIKey | HBRWXXCEDZRIPK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |