C11H12Br2N2O2 — CID 107599564
N-(2,6-dibromophenyl)morpholine-3-carboxamide (PubChem CID 107599564) has the molecular formula C11H12Br2N2O2 and a molecular weight of 364.04 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)morpholine-3-carboxamide.
| Compound Name | N-(2,6-dibromophenyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 107599564 |
| Molecular Formula | C11H12Br2N2O2 |
| Molecular Weight | 364.04 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | N-(2,6-dibromophenyl)morpholine-3-carboxamide |
| SMILES | O=C(Nc1c(Br)cccc1Br)C1COCCN1 |
| InChI | InChI=1S/C11H12Br2N2O2/c12-7-2-1-3-8(13)10(7)15-11(16)9-6-17-5-4-14-9/h1-3,9,14H,4-6H2,(H,15,16) |
| InChIKey | FXHLCLHPUMKSOX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.04 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |