C9H11BrN2OS — CID 115159357
N-(5-bromothiophen-2-yl)pyrrolidine-3-carboxamide (PubChem CID 115159357) has the molecular formula C9H11BrN2OS and a molecular weight of 275.17 g/mol. Its IUPAC name is N-(5-bromothiophen-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | N-(5-bromothiophen-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 115159357 |
| Molecular Formula | C9H11BrN2OS |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | N-(5-bromothiophen-2-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)s1)C1CCNC1 |
| InChI | InChI=1S/C9H11BrN2OS/c10-7-1-2-8(14-7)12-9(13)6-3-4-11-5-6/h1-2,6,11H,3-5H2,(H,12,13) |
| InChIKey | NFHPORHLFNPCKJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |