C11H16BrClN2OS — CID 119699604
N-[2-(5-bromothiophen-2-yl)ethyl]pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119699604) has the molecular formula C11H16BrClN2OS and a molecular weight of 339.69 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119699604 |
| Molecular Formula | C11H16BrClN2OS |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCc1ccc(Br)s1)C1CCNC1 |
| InChI | InChI=1S/C11H15BrN2OS.ClH/c12-10-2-1-9(16-10)4-6-14-11(15)8-3-5-13-7-8;/h1-2,8,13H,3-7H2,(H,14,15);1H |
| InChIKey | YXOLVGFNDVPVIA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |