C14H20N2O3 — CID 115177555
N-(4-methoxy-2,3-dimethylphenyl)morpholine-3-carboxamide (PubChem CID 115177555) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(4-methoxy-2,3-dimethylphenyl)morpholine-3-carboxamide.
| Compound Name | N-(4-methoxy-2,3-dimethylphenyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 115177555 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(4-methoxy-2,3-dimethylphenyl)morpholine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2COCCN2)c(C)c1C |
| InChI | InChI=1S/C14H20N2O3/c1-9-10(2)13(18-3)5-4-11(9)16-14(17)12-8-19-7-6-15-12/h4-5,12,15H,6-8H2,1-3H3,(H,16,17) |
| InChIKey | WJUBNWALHWOCSV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |