C13H19ClN2O4 — CID 119673632
N-(3,4-dimethoxyphenyl)morpholine-3-carboxamide;hydrochloride (PubChem CID 119673632) has the molecular formula C13H19ClN2O4 and a molecular weight of 302.76 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-(3,4-dimethoxyphenyl)morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119673632 |
| Molecular Formula | C13H19ClN2O4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)morpholine-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C2COCCN2)cc1OC.Cl |
| InChI | InChI=1S/C13H18N2O4.ClH/c1-17-11-4-3-9(7-12(11)18-2)15-13(16)10-8-19-6-5-14-10;/h3-4,7,10,14H,5-6,8H2,1-2H3,(H,15,16);1H |
| InChIKey | JXAJCAAHYTUXLL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |