C13H15ClN2O4 — CID 119794095
methyl 2-chloro-4-(morpholine-3-carbonylamino)benzoate (PubChem CID 119794095) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is methyl 2-chloro-4-(morpholine-3-carbonylamino)benzoate.
| Compound Name | methyl 2-chloro-4-(morpholine-3-carbonylamino)benzoate |
|---|---|
| PubChem CID | 119794095 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | methyl 2-chloro-4-(morpholine-3-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2COCCN2)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O4/c1-19-13(18)9-3-2-8(6-10(9)14)16-12(17)11-7-20-5-4-15-11/h2-3,6,11,15H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | LDZXEKCMPNKNRX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |