C15H23Cl2N3O4S — CID 119679883
N-[4-chloro-3-(diethylsulfamoyl)phenyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 119679883) has the molecular formula C15H23Cl2N3O4S and a molecular weight of 412.34 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119679883 |
| Molecular Formula | C15H23Cl2N3O4S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)C2COCCN2)ccc1Cl.Cl |
| InChI | InChI=1S/C15H22ClN3O4S.ClH/c1-3-19(4-2)24(21,22)14-9-11(5-6-12(14)16)18-15(20)13-10-23-8-7-17-13;/h5-6,9,13,17H,3-4,7-8,10H2,1-2H3,(H,18,20);1H |
| InChIKey | IYBGGWKFUMVCJV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |