C16H24N2O3 — CID 124681532
(3S)-N-[2-methyl-3-(propan-2-yloxymethyl)phenyl]morpholine-3-carboxamide (PubChem CID 124681532) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3S)-N-[2-methyl-3-(propan-2-yloxymethyl)phenyl]morpholine-3-carboxamide.
| Compound Name | (3S)-N-[2-methyl-3-(propan-2-yloxymethyl)phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 124681532 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3S)-N-[2-methyl-3-(propan-2-yloxymethyl)phenyl]morpholine-3-carboxamide |
| SMILES | Cc1c(COC(C)C)cccc1NC(=O)[C@@H]1COCCN1 |
| InChI | InChI=1S/C16H24N2O3/c1-11(2)21-9-13-5-4-6-14(12(13)3)18-16(19)15-10-20-8-7-17-15/h4-6,11,15,17H,7-10H2,1-3H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | JPILZZGVYVIQTM-HNNXBMFYSA-N |
| XLogP | 1.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |