C12H16ClFN2O3 — CID 119788904
N-(2-fluoro-5-methoxyphenyl)morpholine-3-carboxamide;hydrochloride (PubChem CID 119788904) has the molecular formula C12H16ClFN2O3 and a molecular weight of 290.72 g/mol. Its IUPAC name is N-(2-fluoro-5-methoxyphenyl)morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-fluoro-5-methoxyphenyl)morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119788904 |
| Molecular Formula | C12H16ClFN2O3 |
| Molecular Weight | 290.72 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-(2-fluoro-5-methoxyphenyl)morpholine-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(F)c(NC(=O)C2COCCN2)c1.Cl |
| InChI | InChI=1S/C12H15FN2O3.ClH/c1-17-8-2-3-9(13)10(6-8)15-12(16)11-7-18-5-4-14-11;/h2-3,6,11,14H,4-5,7H2,1H3,(H,15,16);1H |
| InChIKey | KWQBTXDFWCESEO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.72 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |