C14H21ClN2O4 — CID 119694151
N-[2-(4-methoxyphenoxy)ethyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 119694151) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.78 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119694151 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(OCCNC(=O)C2COCCN2)cc1.Cl |
| InChI | InChI=1S/C14H20N2O4.ClH/c1-18-11-2-4-12(5-3-11)20-9-7-16-14(17)13-10-19-8-6-15-13;/h2-5,13,15H,6-10H2,1H3,(H,16,17);1H |
| InChIKey | YZJMZYXUUBXRKN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|