C17H27N3O3 — CID 119877252
N-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]morpholine-3-carboxamide (PubChem CID 119877252) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]morpholine-3-carboxamide.
| Compound Name | N-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119877252 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]morpholine-3-carboxamide |
| SMILES | CN(C)CCCOc1ccc(CNC(=O)C2COCCN2)cc1 |
| InChI | InChI=1S/C17H27N3O3/c1-20(2)9-3-10-23-15-6-4-14(5-7-15)12-19-17(21)16-13-22-11-8-18-16/h4-7,16,18H,3,8-13H2,1-2H3,(H,19,21) |
| InChIKey | UHHZOILIDDSZOK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|