C18H18Cl2N2O3 — CID 119800989
N-[[4-(2,3-dichlorophenoxy)phenyl]methyl]morpholine-3-carboxamide (PubChem CID 119800989) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is N-[[4-(2,3-dichlorophenoxy)phenyl]methyl]morpholine-3-carboxamide.
| Compound Name | N-[[4-(2,3-dichlorophenoxy)phenyl]methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119800989 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-[[4-(2,3-dichlorophenoxy)phenyl]methyl]morpholine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Oc2cccc(Cl)c2Cl)cc1)C1COCCN1 |
| InChI | InChI=1S/C18H18Cl2N2O3/c19-14-2-1-3-16(17(14)20)25-13-6-4-12(5-7-13)10-22-18(23)15-11-24-9-8-21-15/h1-7,15,21H,8-11H2,(H,22,23) |
| InChIKey | DTGCKHSFMDXYRQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |