C14H21ClN2O3 — CID 119747493
N-[(3-methoxy-4-methylphenyl)methyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 119747493) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is N-[(3-methoxy-4-methylphenyl)methyl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-[(3-methoxy-4-methylphenyl)methyl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119747493 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-[(3-methoxy-4-methylphenyl)methyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | COc1cc(CNC(=O)C2COCCN2)ccc1C.Cl |
| InChI | InChI=1S/C14H20N2O3.ClH/c1-10-3-4-11(7-13(10)18-2)8-16-14(17)12-9-19-6-5-15-12;/h3-4,7,12,15H,5-6,8-9H2,1-2H3,(H,16,17);1H |
| InChIKey | IXGYBRLVDVKOPP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |