C17H24N2O4 — CID 119763446
N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]morpholine-3-carboxamide (PubChem CID 119763446) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]morpholine-3-carboxamide.
| Compound Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119763446 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]morpholine-3-carboxamide |
| SMILES | C=CCc1cc(CNC(=O)C2COCCN2)cc(OC)c1OC |
| InChI | InChI=1S/C17H24N2O4/c1-4-5-13-8-12(9-15(21-2)16(13)22-3)10-19-17(20)14-11-23-7-6-18-14/h4,8-9,14,18H,1,5-7,10-11H2,2-3H3,(H,19,20) |
| InChIKey | IVQGZLCPHIUDSF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|