C19H29ClN2O3 — CID 119763451
3-amino-N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119763451) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is 3-amino-N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119763451 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 3-amino-N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | C=CCc1cc(CNC(=O)C2CCCC(N)C2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C19H28N2O3.ClH/c1-4-6-14-9-13(10-17(23-2)18(14)24-3)12-21-19(22)15-7-5-8-16(20)11-15;/h4,9-10,15-16H,1,5-8,11-12,20H2,2-3H3,(H,21,22);1H |
| InChIKey | DLRUPFXZVFDGFC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|