C17H27ClN2O3 — CID 119763447
N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119763447) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119763447 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | C=CCc1cc(CNC(=O)CCCNC)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C17H26N2O3.ClH/c1-5-7-14-10-13(11-15(21-3)17(14)22-4)12-19-16(20)8-6-9-18-2;/h5,10-11,18H,1,6-9,12H2,2-4H3,(H,19,20);1H |
| InChIKey | YXCNUFPPUJHBOS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|