C22H25NO5 — CID 119183354
4-[3-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]-3-oxopropyl]benzoic acid (PubChem CID 119183354) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 4-[3-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 119183354 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 4-[3-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]-3-oxopropyl]benzoic acid |
| SMILES | C=CCc1cc(CNC(=O)CCc2ccc(C(=O)O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25NO5/c1-4-5-18-12-16(13-19(27-2)21(18)28-3)14-23-20(24)11-8-15-6-9-17(10-7-15)22(25)26/h4,6-7,9-10,12-13H,1,5,8,11,14H2,2-3H3,(H,23,24)(H,25,26) |
| InChIKey | HJLSIBMEEFWLDX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|