C8H16N2O3 — CID 96998631
(3S)-N-(2-methoxyethyl)morpholine-3-carboxamide (PubChem CID 96998631) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is (3S)-N-(2-methoxyethyl)morpholine-3-carboxamide.
| Compound Name | (3S)-N-(2-methoxyethyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 96998631 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (3S)-N-(2-methoxyethyl)morpholine-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1COCCN1 |
| InChI | InChI=1S/C8H16N2O3/c1-12-4-2-10-8(11)7-6-13-5-3-9-7/h7,9H,2-6H2,1H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | OWLIDTHAVMYBKQ-ZETCQYMHSA-N |
| XLogP | -1.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|