C13H25N3O3 — CID 119874815
N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]morpholine-3-carboxamide (PubChem CID 119874815) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]morpholine-3-carboxamide.
| Compound Name | N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119874815 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]morpholine-3-carboxamide |
| SMILES | COCCN1CCCC1CNC(=O)C1COCCN1 |
| InChI | InChI=1S/C13H25N3O3/c1-18-8-6-16-5-2-3-11(16)9-15-13(17)12-10-19-7-4-14-12/h11-12,14H,2-10H2,1H3,(H,15,17) |
| InChIKey | BFPLEVMQVIKNPG-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |