C9H16N2O4 — CID 118107617
2-[[(3S)-morpholine-3-carbonyl]amino]ethyl acetate (PubChem CID 118107617) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[[(3S)-morpholine-3-carbonyl]amino]ethyl acetate.
| Compound Name | 2-[[(3S)-morpholine-3-carbonyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 118107617 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-[[(3S)-morpholine-3-carbonyl]amino]ethyl acetate |
| SMILES | CC(=O)OCCNC(=O)[C@@H]1COCCN1 |
| InChI | InChI=1S/C9H16N2O4/c1-7(12)15-5-3-11-9(13)8-6-14-4-2-10-8/h8,10H,2-6H2,1H3,(H,11,13)/t8-/m0/s1 |
| InChIKey | ZDUMLMQSSJABIR-QMMMGPOBSA-N |
| XLogP | -1.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|