C8H15N3O4 — CID 83209608
2-(morpholine-3-carbonylamino)ethyl carbamate (PubChem CID 83209608) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-(morpholine-3-carbonylamino)ethyl carbamate.
| Compound Name | 2-(morpholine-3-carbonylamino)ethyl carbamate |
|---|---|
| PubChem CID | 83209608 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-(morpholine-3-carbonylamino)ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)C1COCCN1 |
| InChI | InChI=1S/C8H15N3O4/c9-8(13)15-4-2-11-7(12)6-5-14-3-1-10-6/h6,10H,1-5H2,(H2,9,13)(H,11,12) |
| InChIKey | PRHDSWMTVQYQKN-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|