C12H15Cl2N3O3 — CID 124698235
(3R)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]morpholine-3-carboxamide (PubChem CID 124698235) has the molecular formula C12H15Cl2N3O3 and a molecular weight of 320.18 g/mol. Its IUPAC name is (3R)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]morpholine-3-carboxamide.
| Compound Name | (3R)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 124698235 |
| Molecular Formula | C12H15Cl2N3O3 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (3R)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]morpholine-3-carboxamide |
| SMILES | O=C(NCCOc1ncc(Cl)cc1Cl)[C@H]1COCCN1 |
| InChI | InChI=1S/C12H15Cl2N3O3/c13-8-5-9(14)12(17-6-8)20-4-2-16-11(18)10-7-19-3-1-15-10/h5-6,10,15H,1-4,7H2,(H,16,18)/t10-/m1/s1 |
| InChIKey | PZBFFZSRTLOJMJ-SNVBAGLBSA-N |
| XLogP | 0.87 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|