C13H19Cl4N3O2 — CID 119900807
N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]piperidine-3-carboxamide;dihydrochloride (PubChem CID 119900807) has the molecular formula C13H19Cl4N3O2 and a molecular weight of 391.13 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]piperidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119900807 |
| Molecular Formula | C13H19Cl4N3O2 |
| Molecular Weight | 391.13 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]piperidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCOc1ncc(Cl)cc1Cl)C1CCCNC1 |
| InChI | InChI=1S/C13H17Cl2N3O2.2ClH/c14-10-6-11(15)13(18-8-10)20-5-4-17-12(19)9-2-1-3-16-7-9;;/h6,8-9,16H,1-5,7H2,(H,17,19);2*1H |
| InChIKey | UHSGQZZLEPQQQF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|