C13H16Cl2N2O — CID 94705337
(3R)-N-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 94705337) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is (3R)-N-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94705337 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (3R)-N-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C13H16Cl2N2O/c14-11-4-3-9(12(15)6-11)8-17-13(18)10-2-1-5-16-7-10/h3-4,6,10,16H,1-2,5,7-8H2,(H,17,18)/t10-/m1/s1 |
| InChIKey | BIQQOAZDVYCETP-SNVBAGLBSA-N |
| XLogP | 2.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |