C13H15F3N2O — CID 110482453
N-[(2,4,6-trifluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 110482453) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is N-[(2,4,6-trifluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-[(2,4,6-trifluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110482453 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-[(2,4,6-trifluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)C1CCCNC1 |
| InChI | InChI=1S/C13H15F3N2O/c14-9-4-11(15)10(12(16)5-9)7-18-13(19)8-2-1-3-17-6-8/h4-5,8,17H,1-3,6-7H2,(H,18,19) |
| InChIKey | QJHLJLIZOABJKJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |