C13H17Cl2N3O3 — CID 120801562
(2S,5R)-5-(aminomethyl)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]oxolane-2-carboxamide (PubChem CID 120801562) has the molecular formula C13H17Cl2N3O3 and a molecular weight of 334.20 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120801562 |
| Molecular Formula | C13H17Cl2N3O3 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]oxolane-2-carboxamide |
| SMILES | NC[C@H]1CC[C@@H](C(=O)NCCOc2ncc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C13H17Cl2N3O3/c14-8-5-10(15)13(18-7-8)20-4-3-17-12(19)11-2-1-9(6-16)21-11/h5,7,9,11H,1-4,6,16H2,(H,17,19)/t9-,11+/m1/s1 |
| InChIKey | XXLRRJGSQTVWMF-KOLCDFICSA-N |
| XLogP | 1.39 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|