C15H23ClN2O4 — CID 120919950
(2R,3S)-N-[2-(4-methoxyphenoxy)ethyl]-2-methylmorpholine-3-carboxamide;hydrochloride (PubChem CID 120919950) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is (2R,3S)-N-[2-(4-methoxyphenoxy)ethyl]-2-methylmorpholine-3-carboxamide;hydrochloride.
| Compound Name | (2R,3S)-N-[2-(4-methoxyphenoxy)ethyl]-2-methylmorpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120919950 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2R,3S)-N-[2-(4-methoxyphenoxy)ethyl]-2-methylmorpholine-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(OCCNC(=O)[C@H]2NCCO[C@@H]2C)cc1.Cl |
| InChI | InChI=1S/C15H22N2O4.ClH/c1-11-14(16-7-9-20-11)15(18)17-8-10-21-13-5-3-12(19-2)4-6-13;/h3-6,11,14,16H,7-10H2,1-2H3,(H,17,18);1H/t11-,14+;/m1./s1 |
| InChIKey | NSKLSSSAJRDLKF-GGMFNZDASA-N |
| XLogP | 0.99 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|