C16H23N3O4 — CID 120923637
(2R,3S)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-2-methylmorpholine-3-carboxamide (PubChem CID 120923637) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2R,3S)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-2-methylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-2-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 120923637 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2R,3S)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-2-methylmorpholine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)[C@H]2NCCO[C@@H]2C)cc1 |
| InChI | InChI=1S/C16H23N3O4/c1-11-14(17-9-10-23-11)16(21)19-8-7-18-15(20)12-3-5-13(22-2)6-4-12/h3-6,11,14,17H,7-10H2,1-2H3,(H,18,20)(H,19,21)/t11-,14+/m1/s1 |
| InChIKey | MHQYMSKICHIJDR-RISCZKNCSA-N |
| XLogP | -0.08 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|