C17H26ClN3O3 — CID 120621809
(2S,4S)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120621809) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is (2S,4S)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120621809 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (2S,4S)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
| SMILES | COc1ccc(C(=O)NCCNC(=O)[C@H]2CCN[C@@H](C)C2)cc1.Cl |
| InChI | InChI=1S/C17H25N3O3.ClH/c1-12-11-14(7-8-18-12)17(22)20-10-9-19-16(21)13-3-5-15(23-2)6-4-13;/h3-6,12,14,18H,7-11H2,1-2H3,(H,19,21)(H,20,22);1H/t12-,14-;/m0./s1 |
| InChIKey | AIPQKSYIZBZZQV-KYSPHBLOSA-N |
| XLogP | 1.35 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|