C15H22N2O2 — CID 120617690
(2S,4S)-2-methyl-N-(2-phenoxyethyl)piperidine-4-carboxamide (PubChem CID 120617690) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-(2-phenoxyethyl)piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-(2-phenoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120617690 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2S,4S)-2-methyl-N-(2-phenoxyethyl)piperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)NCCOc2ccccc2)CCN1 |
| InChI | InChI=1S/C15H22N2O2/c1-12-11-13(7-8-16-12)15(18)17-9-10-19-14-5-3-2-4-6-14/h2-6,12-13,16H,7-11H2,1H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | OLFUKIYVRRHYOL-STQMWFEESA-N |
| XLogP | 1.57 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|