C24H33ClN2O2 — CID 120631933
(2S,4S)-2-methyl-N-[2-[3-(3-phenylpropoxy)phenyl]ethyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 120631933) has the molecular formula C24H33ClN2O2 and a molecular weight of 416.99 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-[2-[3-(3-phenylpropoxy)phenyl]ethyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-2-methyl-N-[2-[3-(3-phenylpropoxy)phenyl]ethyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120631933 |
| Molecular Formula | C24H33ClN2O2 |
| Molecular Weight | 416.99 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (2S,4S)-2-methyl-N-[2-[3-(3-phenylpropoxy)phenyl]ethyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | C[C@H]1C[C@@H](C(=O)NCCc2cccc(OCCCc3ccccc3)c2)CCN1.Cl |
| InChI | InChI=1S/C24H32N2O2.ClH/c1-19-17-22(13-15-25-19)24(27)26-14-12-21-9-5-11-23(18-21)28-16-6-10-20-7-3-2-4-8-20;/h2-5,7-9,11,18-19,22,25H,6,10,12-17H2,1H3,(H,26,27);1H/t19-,22-;/m0./s1 |
| InChIKey | JIJYJBQQOZGPRZ-CQERKEQDSA-N |
| XLogP | 4.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.99 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|