C15H21ClF2N2O2 — CID 120631586
(2S,4S)-N-[2-(3,4-difluorophenoxy)ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120631586) has the molecular formula C15H21ClF2N2O2 and a molecular weight of 334.79 g/mol. Its IUPAC name is (2S,4S)-N-[2-(3,4-difluorophenoxy)ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N-[2-(3,4-difluorophenoxy)ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120631586 |
| Molecular Formula | C15H21ClF2N2O2 |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (2S,4S)-N-[2-(3,4-difluorophenoxy)ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
| SMILES | C[C@H]1C[C@@H](C(=O)NCCOc2ccc(F)c(F)c2)CCN1.Cl |
| InChI | InChI=1S/C15H20F2N2O2.ClH/c1-10-8-11(4-5-18-10)15(20)19-6-7-21-12-2-3-13(16)14(17)9-12;/h2-3,9-11,18H,4-8H2,1H3,(H,19,20);1H/t10-,11-;/m0./s1 |
| InChIKey | CYJAWTWBMCAMTJ-ACMTZBLWSA-N |
| XLogP | 2.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|