C16H19F2NO4 — CID 124614733
cis-(1S,3R)-3-[2-(3,4-difluorophenoxy)ethylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 124614733) has the molecular formula C16H19F2NO4 and a molecular weight of 327.33 g/mol. Its IUPAC name is cis-(1S,3R)-3-[2-(3,4-difluorophenoxy)ethylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[2-(3,4-difluorophenoxy)ethylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 124614733 |
| Molecular Formula | C16H19F2NO4 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | cis-(1S,3R)-3-[2-(3,4-difluorophenoxy)ethylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCC[C@@H](C(=O)NCCOc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C16H19F2NO4/c17-13-5-4-12(9-14(13)18)23-7-6-19-15(20)10-2-1-3-11(8-10)16(21)22/h4-5,9-11H,1-3,6-8H2,(H,19,20)(H,21,22)/t10-,11+/m1/s1 |
| InChIKey | XJAVQGLYOGDJGZ-MNOVXSKESA-N |
| XLogP | 2.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|