C15H19F2N3O3 — CID 95614768
(3S)-3-N-[2-(3,4-difluorophenoxy)ethyl]piperidine-1,3-dicarboxamide (PubChem CID 95614768) has the molecular formula C15H19F2N3O3 and a molecular weight of 327.33 g/mol. Its IUPAC name is (3S)-3-N-[2-(3,4-difluorophenoxy)ethyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[2-(3,4-difluorophenoxy)ethyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95614768 |
| Molecular Formula | C15H19F2N3O3 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (3S)-3-N-[2-(3,4-difluorophenoxy)ethyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@H](C(=O)NCCOc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H19F2N3O3/c16-12-4-3-11(8-13(12)17)23-7-5-19-14(21)10-2-1-6-20(9-10)15(18)22/h3-4,8,10H,1-2,5-7,9H2,(H2,18,22)(H,19,21)/t10-/m0/s1 |
| InChIKey | JZLLQMAUJTUMRF-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|