C15H20ClN3O2 — CID 9081950
(3S)-3-N-[2-(4-chlorophenyl)ethyl]piperidine-1,3-dicarboxamide (PubChem CID 9081950) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is (3S)-3-N-[2-(4-chlorophenyl)ethyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[2-(4-chlorophenyl)ethyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 9081950 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (3S)-3-N-[2-(4-chlorophenyl)ethyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@H](C(=O)NCCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H20ClN3O2/c16-13-5-3-11(4-6-13)7-8-18-14(20)12-2-1-9-19(10-12)15(17)21/h3-6,12H,1-2,7-10H2,(H2,17,21)(H,18,20)/t12-/m0/s1 |
| InChIKey | MSGUZNBDSFNPTI-LBPRGKRZSA-N |
| XLogP | 1.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |