C15H19Cl2N3O2 — CID 95156511
(3R)-3-N-[2-(2,3-dichlorophenyl)ethyl]piperidine-1,3-dicarboxamide (PubChem CID 95156511) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is (3R)-3-N-[2-(2,3-dichlorophenyl)ethyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[2-(2,3-dichlorophenyl)ethyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95156511 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (3R)-3-N-[2-(2,3-dichlorophenyl)ethyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@@H](C(=O)NCCc2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C15H19Cl2N3O2/c16-12-5-1-3-10(13(12)17)6-7-19-14(21)11-4-2-8-20(9-11)15(18)22/h1,3,5,11H,2,4,6-9H2,(H2,18,22)(H,19,21)/t11-/m1/s1 |
| InChIKey | MVKRKFVCKQFEEX-LLVKDONJSA-N |
| XLogP | 2.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |