C14H17ClN4O3 — CID 8870376
(3R)-3-[[(2-chlorobenzoyl)amino]carbamoyl]piperidine-1-carboxamide (PubChem CID 8870376) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is (3R)-3-[[(2-chlorobenzoyl)amino]carbamoyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[[(2-chlorobenzoyl)amino]carbamoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 8870376 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (3R)-3-[[(2-chlorobenzoyl)amino]carbamoyl]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC[C@@H](C(=O)NNC(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C14H17ClN4O3/c15-11-6-2-1-5-10(11)13(21)18-17-12(20)9-4-3-7-19(8-9)14(16)22/h1-2,5-6,9H,3-4,7-8H2,(H2,16,22)(H,17,20)(H,18,21)/t9-/m1/s1 |
| InChIKey | DHXQCZDESVRFQS-SECBINFHSA-N |
| XLogP | 0.89 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|