C15H20N4O3 — CID 9086796
(3S)-3-[[(4-methylbenzoyl)amino]carbamoyl]piperidine-1-carboxamide (PubChem CID 9086796) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is (3S)-3-[[(4-methylbenzoyl)amino]carbamoyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-[[(4-methylbenzoyl)amino]carbamoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 9086796 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (3S)-3-[[(4-methylbenzoyl)amino]carbamoyl]piperidine-1-carboxamide |
| SMILES | Cc1ccc(C(=O)NNC(=O)[C@H]2CCCN(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C15H20N4O3/c1-10-4-6-11(7-5-10)13(20)17-18-14(21)12-3-2-8-19(9-12)15(16)22/h4-7,12H,2-3,8-9H2,1H3,(H2,16,22)(H,17,20)(H,18,21)/t12-/m0/s1 |
| InChIKey | HLMBFCGPCIOWMD-LBPRGKRZSA-N |
| XLogP | 0.55 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|