C17H24N4O4 — CID 9085756
(3S)-3-[[[2-(3,5-dimethylphenoxy)acetyl]amino]carbamoyl]piperidine-1-carboxamide (PubChem CID 9085756) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (3S)-3-[[[2-(3,5-dimethylphenoxy)acetyl]amino]carbamoyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-[[[2-(3,5-dimethylphenoxy)acetyl]amino]carbamoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 9085756 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (3S)-3-[[[2-(3,5-dimethylphenoxy)acetyl]amino]carbamoyl]piperidine-1-carboxamide |
| SMILES | Cc1cc(C)cc(OCC(=O)NNC(=O)[C@H]2CCCN(C(N)=O)C2)c1 |
| InChI | InChI=1S/C17H24N4O4/c1-11-6-12(2)8-14(7-11)25-10-15(22)19-20-16(23)13-4-3-5-21(9-13)17(18)24/h6-8,13H,3-5,9-10H2,1-2H3,(H2,18,24)(H,19,22)(H,20,23)/t13-/m0/s1 |
| InChIKey | FQQUWNOCYBDMRX-ZDUSSCGKSA-N |
| XLogP | 0.62 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|