About 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide
3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide (PubChem CID 70730280) has the molecular formula C18H27N3O3
and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide |
| PubChem CID | 70730280 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide |
| SMILES | Cc1ccc(OCCCN(C)C(=O)C2CCCN(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C18H27N3O3/c1-14-6-8-16(9-7-14)24-12-4-10-20(2)17(22)15-5-3-11-21(13-15)18(19)23/h6-9,15H,3-5,10-13H2,1-2H3,(H2,19,23) |
| InChIKey | GPSSFLHGUMQTTG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide?
The IUPAC name of 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide (CID 70730280) is 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide.
What is the SMILES notation for 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide?
The canonical SMILES for 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide is Cc1ccc(OCCCN(C)C(=O)C2CCCN(C(N)=O)C2)cc1.
What is the InChIKey of 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide?
The InChIKey is GPSSFLHGUMQTTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O3/c1-14-6-8-16(9-7-14)24-12-4-10-20(2)17(22)15-5-3-11-21(13-15)18(19)23/h6-9,15H,3-5,10-13H2,1-2H3,(H2,19,23).
What are the key properties of 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide?
3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide has a molecular weight of 333.43 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-methyl-3-N-[3-(4-methylphenoxy)propyl]piperidine-1,3-dicarboxamide is sourced from PubChem (CID 70730280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).