C23H34N2O3 — CID 55967191
N-(cyclohexylmethyl)-N-methyl-1-(3-phenoxypropanoyl)piperidine-3-carboxamide (PubChem CID 55967191) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-methyl-1-(3-phenoxypropanoyl)piperidine-3-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-N-methyl-1-(3-phenoxypropanoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55967191 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | N-(cyclohexylmethyl)-N-methyl-1-(3-phenoxypropanoyl)piperidine-3-carboxamide |
| SMILES | CN(CC1CCCCC1)C(=O)C1CCCN(C(=O)CCOc2ccccc2)C1 |
| InChI | InChI=1S/C23H34N2O3/c1-24(17-19-9-4-2-5-10-19)23(27)20-11-8-15-25(18-20)22(26)14-16-28-21-12-6-3-7-13-21/h3,6-7,12-13,19-20H,2,4-5,8-11,14-18H2,1H3 |
| InChIKey | ITVJPQQIWQXCRX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |