C23H34N2O3 — CID 108547506
3-cyclohexyl-1-[4-(3-phenoxypropanoyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 108547506) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-cyclohexyl-1-[4-(3-phenoxypropanoyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-1-[4-(3-phenoxypropanoyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 108547506 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 3-cyclohexyl-1-[4-(3-phenoxypropanoyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | O=C(CCOc1ccccc1)N1CCCN(C(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H34N2O3/c26-22(13-12-20-8-3-1-4-9-20)24-15-7-16-25(18-17-24)23(27)14-19-28-21-10-5-2-6-11-21/h2,5-6,10-11,20H,1,3-4,7-9,12-19H2 |
| InChIKey | CBDOYMPYXMZCKR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |